C19H30BNSi — CID 146168317
tert-butyl-dimethyl-[2-(2,4,6-trimethylphenyl)azaborinin-1-yl]silane (PubChem CID 146168317) has the molecular formula C19H30BNSi and a molecular weight of 311.35 g/mol. Its IUPAC name is tert-butyl-dimethyl-[2-(2,4,6-trimethylphenyl)azaborinin-1-yl]silane.
| Compound Name | tert-butyl-dimethyl-[2-(2,4,6-trimethylphenyl)azaborinin-1-yl]silane |
|---|---|
| PubChem CID | 146168317 |
| Molecular Formula | C19H30BNSi |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | tert-butyl-dimethyl-[2-(2,4,6-trimethylphenyl)azaborinin-1-yl]silane |
| SMILES | Cc1cc(C)c(B2C=CC=CN2[Si](C)(C)C(C)(C)C)c(C)c1 |
| InChI | InChI=1S/C19H30BNSi/c1-15-13-16(2)18(17(3)14-15)20-11-9-10-12-21(20)22(7,8)19(4,5)6/h9-14H,1-8H3 |
| InChIKey | QUTPRWUTQUQMQC-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|