C19H24BrNSi2 — CID 134932134
2-[(Z)-2-(4-bromophenyl)prop-1-enyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole (PubChem CID 134932134) has the molecular formula C19H24BrNSi2 and a molecular weight of 402.48 g/mol. Its IUPAC name is 2-[(Z)-2-(4-bromophenyl)prop-1-enyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole.
| Compound Name | 2-[(Z)-2-(4-bromophenyl)prop-1-enyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole |
|---|---|
| PubChem CID | 134932134 |
| Molecular Formula | C19H24BrNSi2 |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 401.06 |
| IUPAC Name | 2-[(Z)-2-(4-bromophenyl)prop-1-enyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole |
| SMILES | C/C(=C/N1[Si](C)(C)c2ccccc2[Si]1(C)C)c1ccc(Br)cc1 |
| InChI | InChI=1S/C19H24BrNSi2/c1-15(16-10-12-17(20)13-11-16)14-21-22(2,3)18-8-6-7-9-19(18)23(21,4)5/h6-14H,1-5H3/b15-14- |
| InChIKey | BHABHJYGCWUZAI-PFONDFGASA-N |
| XLogP | 4.65 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|