C20H27NSi2 — CID 134933436
1,1,3,3-tetramethyl-2-[(Z)-2-methyl-3-phenylprop-1-enyl]-2,1,3-benzazadisilole (PubChem CID 134933436) has the molecular formula C20H27NSi2 and a molecular weight of 337.62 g/mol. Its IUPAC name is 1,1,3,3-tetramethyl-2-[(Z)-2-methyl-3-phenylprop-1-enyl]-2,1,3-benzazadisilole.
| Compound Name | 1,1,3,3-tetramethyl-2-[(Z)-2-methyl-3-phenylprop-1-enyl]-2,1,3-benzazadisilole |
|---|---|
| PubChem CID | 134933436 |
| Molecular Formula | C20H27NSi2 |
| Molecular Weight | 337.62 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 1,1,3,3-tetramethyl-2-[(Z)-2-methyl-3-phenylprop-1-enyl]-2,1,3-benzazadisilole |
| SMILES | C/C(=C/N1[Si](C)(C)c2ccccc2[Si]1(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C20H27NSi2/c1-17(15-18-11-7-6-8-12-18)16-21-22(2,3)19-13-9-10-14-20(19)23(21,4)5/h6-14,16H,15H2,1-5H3/b17-16- |
| InChIKey | YMDKNDRLZADEOB-MSUUIHNZSA-N |
| XLogP | 3.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.62 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|