C16H29NSi3 — CID 134933437
trimethyl-[(Z)-1-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)prop-1-en-2-yl]silane (PubChem CID 134933437) has the molecular formula C16H29NSi3 and a molecular weight of 319.67 g/mol. Its IUPAC name is trimethyl-[(Z)-1-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)prop-1-en-2-yl]silane.
| Compound Name | trimethyl-[(Z)-1-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)prop-1-en-2-yl]silane |
|---|---|
| PubChem CID | 134933437 |
| Molecular Formula | C16H29NSi3 |
| Molecular Weight | 319.67 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | trimethyl-[(Z)-1-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)prop-1-en-2-yl]silane |
| SMILES | C/C(=C/N1[Si](C)(C)c2ccccc2[Si]1(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C16H29NSi3/c1-14(18(2,3)4)13-17-19(5,6)15-11-9-10-12-16(15)20(17,7)8/h9-13H,1-8H3/b14-13- |
| InChIKey | UUFKPDAUJOVRTI-YPKPFQOOSA-N |
| XLogP | 3.61 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.67 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|