C12H19NSi2 — CID 12736304
2-ethenyl-1,1,3,3-tetramethyl-2,1,3-benzazadisilole (PubChem CID 12736304) has the molecular formula C12H19NSi2 and a molecular weight of 233.46 g/mol. Its IUPAC name is 2-ethenyl-1,1,3,3-tetramethyl-2,1,3-benzazadisilole.
| Compound Name | 2-ethenyl-1,1,3,3-tetramethyl-2,1,3-benzazadisilole |
|---|---|
| PubChem CID | 12736304 |
| Molecular Formula | C12H19NSi2 |
| Molecular Weight | 233.46 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | 2-ethenyl-1,1,3,3-tetramethyl-2,1,3-benzazadisilole |
| SMILES | C=CN1[Si](C)(C)c2ccccc2[Si]1(C)C |
| InChI | InChI=1S/C12H19NSi2/c1-6-13-14(2,3)11-9-7-8-10-12(11)15(13,4)5/h6-10H,1H2,2-5H3 |
| InChIKey | LQGQZNUKUIRAGZ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|