C20H24N2Si2 — CID 134933045
2-[(Z)-1-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)prop-1-en-2-yl]benzonitrile (PubChem CID 134933045) has the molecular formula C20H24N2Si2 and a molecular weight of 348.60 g/mol. Its IUPAC name is 2-[(Z)-1-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)prop-1-en-2-yl]benzonitrile.
| Compound Name | 2-[(Z)-1-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)prop-1-en-2-yl]benzonitrile |
|---|---|
| PubChem CID | 134933045 |
| Molecular Formula | C20H24N2Si2 |
| Molecular Weight | 348.60 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | 2-[(Z)-1-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)prop-1-en-2-yl]benzonitrile |
| SMILES | C/C(=C/N1[Si](C)(C)c2ccccc2[Si]1(C)C)c1ccccc1C#N |
| InChI | InChI=1S/C20H24N2Si2/c1-16(18-11-7-6-10-17(18)14-21)15-22-23(2,3)19-12-8-9-13-20(19)24(22,4)5/h6-13,15H,1-5H3/b16-15- |
| InChIKey | DKRXUPCMZJETAY-NXVVXOECSA-N |
| XLogP | 3.76 |
| TPSA | 27.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.60 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|