C24H26BrNSi2 — CID 134933048
2-[(Z)-2-(4-bromophenyl)-2-phenylethenyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole (PubChem CID 134933048) has the molecular formula C24H26BrNSi2 and a molecular weight of 464.56 g/mol. Its IUPAC name is 2-[(Z)-2-(4-bromophenyl)-2-phenylethenyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole.
| Compound Name | 2-[(Z)-2-(4-bromophenyl)-2-phenylethenyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole |
|---|---|
| PubChem CID | 134933048 |
| Molecular Formula | C24H26BrNSi2 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 463.08 |
| IUPAC Name | 2-[(Z)-2-(4-bromophenyl)-2-phenylethenyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole |
| SMILES | C[Si]1(C)c2ccccc2[Si](C)(C)N1/C=C(/c1ccccc1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C24H26BrNSi2/c1-27(2)23-12-8-9-13-24(23)28(3,4)26(27)18-22(19-10-6-5-7-11-19)20-14-16-21(25)17-15-20/h5-18H,1-4H3/b22-18- |
| InChIKey | AAKGMQJJWPKWJX-PYCFMQQDSA-N |
| XLogP | 5.68 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|