C17H31NOSi3 — CID 134932740
trimethyl-[(Z)-2-methyl-3-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)prop-2-enoxy]silane (PubChem CID 134932740) has the molecular formula C17H31NOSi3 and a molecular weight of 349.70 g/mol. Its IUPAC name is trimethyl-[(Z)-2-methyl-3-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)prop-2-enoxy]silane.
| Compound Name | trimethyl-[(Z)-2-methyl-3-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)prop-2-enoxy]silane |
|---|---|
| PubChem CID | 134932740 |
| Molecular Formula | C17H31NOSi3 |
| Molecular Weight | 349.70 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | trimethyl-[(Z)-2-methyl-3-(1,1,3,3-tetramethyl-2,1,3-benzazadisilol-2-yl)prop-2-enoxy]silane |
| SMILES | C/C(=C/N1[Si](C)(C)c2ccccc2[Si]1(C)C)CO[Si](C)(C)C |
| InChI | InChI=1S/C17H31NOSi3/c1-15(14-19-20(2,3)4)13-18-21(5,6)16-11-9-10-12-17(16)22(18,7)8/h9-13H,14H2,1-8H3/b15-13- |
| InChIKey | DWXGGAAQPUNELV-SQFISAMPSA-N |
| XLogP | 3.58 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.70 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|