C14H23NOSi2 — CID 134933135
2-[(Z)-2-methoxyprop-1-enyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole (PubChem CID 134933135) has the molecular formula C14H23NOSi2 and a molecular weight of 277.52 g/mol. Its IUPAC name is 2-[(Z)-2-methoxyprop-1-enyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole.
| Compound Name | 2-[(Z)-2-methoxyprop-1-enyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole |
|---|---|
| PubChem CID | 134933135 |
| Molecular Formula | C14H23NOSi2 |
| Molecular Weight | 277.52 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-[(Z)-2-methoxyprop-1-enyl]-1,1,3,3-tetramethyl-2,1,3-benzazadisilole |
| SMILES | CO/C(C)=C\N1[Si](C)(C)c2ccccc2[Si]1(C)C |
| InChI | InChI=1S/C14H23NOSi2/c1-12(16-2)11-15-17(3,4)13-9-7-8-10-14(13)18(15,5)6/h7-11H,1-6H3/b12-11- |
| InChIKey | GUBJFTNJEWHPNU-QXMHVHEDSA-N |
| XLogP | 2.33 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|