C27H16N6O — CID 118104663
10-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-oxa-6,10,12-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11(16),12,14-heptaene (PubChem CID 118104663) has the molecular formula C27H16N6O and a molecular weight of 440.47 g/mol. Its IUPAC name is 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-oxa-6,10,12-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11(16),12,14-heptaene.
| Compound Name | 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-oxa-6,10,12-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11(16),12,14-heptaene |
|---|---|
| PubChem CID | 118104663 |
| Molecular Formula | C27H16N6O |
| Molecular Weight | 440.47 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | 10-(4,6-diphenyl-1,3,5-triazin-2-yl)-8-oxa-6,10,12-triazatetracyclo[7.7.0.02,7.011,16]hexadeca-1(9),2(7),3,5,11(16),12,14-heptaene |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-n3c4ncccc4c4c5cccnc5oc43)n2)cc1 |
| InChI | InChI=1S/C27H16N6O/c1-3-9-17(10-4-1)22-30-23(18-11-5-2-6-12-18)32-27(31-22)33-24-19(13-7-15-28-24)21-20-14-8-16-29-25(20)34-26(21)33/h1-16H |
| InChIKey | QFORKVIYQGNXPA-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.47 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |