C16H17F3N2O3 — CID 118104990
2-[4-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]pentanoic acid (PubChem CID 118104990) has the molecular formula C16H17F3N2O3 and a molecular weight of 342.32 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]pentanoic acid.
| Compound Name | 2-[4-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]pentanoic acid |
|---|---|
| PubChem CID | 118104990 |
| Molecular Formula | C16H17F3N2O3 |
| Molecular Weight | 342.32 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)-3-(trifluoromethyl)pyrazol-1-yl]pentanoic acid |
| SMILES | CCCC(C(=O)O)n1cc(-c2ccc(OC)cc2)c(C(F)(F)F)n1 |
| InChI | InChI=1S/C16H17F3N2O3/c1-3-4-13(15(22)23)21-9-12(14(20-21)16(17,18)19)10-5-7-11(24-2)8-6-10/h5-9,13H,3-4H2,1-2H3,(H,22,23) |
| InChIKey | BCCSKRAYOLXFFF-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.32 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |