C21H26FN5O2 — CID 118108163
2-cyclopropyl-N'-[6-[4-(2-fluoro-6-methoxyphenyl)piperidin-1-yl]pyrimidin-4-yl]acetohydrazide (PubChem CID 118108163) has the molecular formula C21H26FN5O2 and a molecular weight of 399.47 g/mol. Its IUPAC name is 2-cyclopropyl-N'-[6-[4-(2-fluoro-6-methoxyphenyl)piperidin-1-yl]pyrimidin-4-yl]acetohydrazide.
| Compound Name | 2-cyclopropyl-N'-[6-[4-(2-fluoro-6-methoxyphenyl)piperidin-1-yl]pyrimidin-4-yl]acetohydrazide |
|---|---|
| PubChem CID | 118108163 |
| Molecular Formula | C21H26FN5O2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | 2-cyclopropyl-N'-[6-[4-(2-fluoro-6-methoxyphenyl)piperidin-1-yl]pyrimidin-4-yl]acetohydrazide |
| SMILES | COc1cccc(F)c1C1CCN(c2cc(NNC(=O)CC3CC3)ncn2)CC1 |
| InChI | InChI=1S/C21H26FN5O2/c1-29-17-4-2-3-16(22)21(17)15-7-9-27(10-8-15)19-12-18(23-13-24-19)25-26-20(28)11-14-5-6-14/h2-4,12-15H,5-11H2,1H3,(H,26,28)(H,23,24,25) |
| InChIKey | VXEGHKSMPXVHIX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|