C8H14F2N2 — CID 118109083
[(1S)-6,6-difluoro-1,2,3,5,7,8-hexahydropyrrolizin-1-yl]methanamine (PubChem CID 118109083) has the molecular formula C8H14F2N2 and a molecular weight of 176.21 g/mol. Its IUPAC name is [(1S)-6,6-difluoro-1,2,3,5,7,8-hexahydropyrrolizin-1-yl]methanamine.
| Compound Name | [(1S)-6,6-difluoro-1,2,3,5,7,8-hexahydropyrrolizin-1-yl]methanamine |
|---|---|
| PubChem CID | 118109083 |
| Molecular Formula | C8H14F2N2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | [(1S)-6,6-difluoro-1,2,3,5,7,8-hexahydropyrrolizin-1-yl]methanamine |
| SMILES | NC[C@@H]1CCN2CC(F)(F)CC12 |
| InChI | InChI=1S/C8H14F2N2/c9-8(10)3-7-6(4-11)1-2-12(7)5-8/h6-7H,1-5,11H2/t6-,7?/m0/s1 |
| InChIKey | RQCBPJFGVVJRCA-PKPIPKONSA-N |
| XLogP | 0.67 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |