C27H33F3N4O3 — CID 118109829
(2S)-N-[4-[6-[[1-(2,2-difluorobutyl)piperidin-4-yl]methoxy]-3-pyridinyl]-2-fluorobenzoyl]pyrrolidine-2-carboxamide (PubChem CID 118109829) has the molecular formula C27H33F3N4O3 and a molecular weight of 518.58 g/mol. Its IUPAC name is (2S)-N-[4-[6-[[1-(2,2-difluorobutyl)piperidin-4-yl]methoxy]-3-pyridinyl]-2-fluorobenzoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-[6-[[1-(2,2-difluorobutyl)piperidin-4-yl]methoxy]-3-pyridinyl]-2-fluorobenzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118109829 |
| Molecular Formula | C27H33F3N4O3 |
| Molecular Weight | 518.58 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | (2S)-N-[4-[6-[[1-(2,2-difluorobutyl)piperidin-4-yl]methoxy]-3-pyridinyl]-2-fluorobenzoyl]pyrrolidine-2-carboxamide |
| SMILES | CCC(F)(F)CN1CCC(COc2ccc(-c3ccc(C(=O)NC(=O)[C@@H]4CCCN4)c(F)c3)cn2)CC1 |
| InChI | InChI=1S/C27H33F3N4O3/c1-2-27(29,30)17-34-12-9-18(10-13-34)16-37-24-8-6-20(15-32-24)19-5-7-21(22(28)14-19)25(35)33-26(36)23-4-3-11-31-23/h5-8,14-15,18,23,31H,2-4,9-13,16-17H2,1H3,(H,33,35,36)/t23-/m0/s1 |
| InChIKey | ZHDNADLDWUMJMI-QHCPKHFHSA-N |
| XLogP | 4.03 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.58 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|