C23H30F2N2O — CID 141382294
2-[[1-(2-ethyl-2-fluorobutyl)piperidin-4-yl]methoxy]-5-(3-fluorophenyl)pyridine (PubChem CID 141382294) has the molecular formula C23H30F2N2O and a molecular weight of 388.50 g/mol. Its IUPAC name is 2-[[1-(2-ethyl-2-fluorobutyl)piperidin-4-yl]methoxy]-5-(3-fluorophenyl)pyridine.
| Compound Name | 2-[[1-(2-ethyl-2-fluorobutyl)piperidin-4-yl]methoxy]-5-(3-fluorophenyl)pyridine |
|---|---|
| PubChem CID | 141382294 |
| Molecular Formula | C23H30F2N2O |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.23 |
| IUPAC Name | 2-[[1-(2-ethyl-2-fluorobutyl)piperidin-4-yl]methoxy]-5-(3-fluorophenyl)pyridine |
| SMILES | CCC(F)(CC)CN1CCC(COc2ccc(-c3cccc(F)c3)cn2)CC1 |
| InChI | InChI=1S/C23H30F2N2O/c1-3-23(25,4-2)17-27-12-10-18(11-13-27)16-28-22-9-8-20(15-26-22)19-6-5-7-21(24)14-19/h5-9,14-15,18H,3-4,10-13,16-17H2,1-2H3 |
| InChIKey | QYQUBAWELTWDCQ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |