C24H30F3NO — CID 141382208
1-(2-ethyl-2-fluorobutyl)-4-[[2-fluoro-4-(2-fluorophenyl)phenoxy]methyl]piperidine (PubChem CID 141382208) has the molecular formula C24H30F3NO and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-(2-ethyl-2-fluorobutyl)-4-[[2-fluoro-4-(2-fluorophenyl)phenoxy]methyl]piperidine.
| Compound Name | 1-(2-ethyl-2-fluorobutyl)-4-[[2-fluoro-4-(2-fluorophenyl)phenoxy]methyl]piperidine |
|---|---|
| PubChem CID | 141382208 |
| Molecular Formula | C24H30F3NO |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | 1-(2-ethyl-2-fluorobutyl)-4-[[2-fluoro-4-(2-fluorophenyl)phenoxy]methyl]piperidine |
| SMILES | CCC(F)(CC)CN1CCC(COc2ccc(-c3ccccc3F)cc2F)CC1 |
| InChI | InChI=1S/C24H30F3NO/c1-3-24(27,4-2)17-28-13-11-18(12-14-28)16-29-23-10-9-19(15-22(23)26)20-7-5-6-8-21(20)25/h5-10,15,18H,3-4,11-14,16-17H2,1-2H3 |
| InChIKey | ZPMQJEDVWGMFDH-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |