C28H38FN5O3 — CID 90018430
(2S)-N-[4-[5-[[1-(2-ethyl-2-fluorobutyl)piperidin-4-yl]methoxy]pyrimidin-2-yl]benzoyl]pyrrolidine-2-carboxamide (PubChem CID 90018430) has the molecular formula C28H38FN5O3 and a molecular weight of 511.64 g/mol. Its IUPAC name is (2S)-N-[4-[5-[[1-(2-ethyl-2-fluorobutyl)piperidin-4-yl]methoxy]pyrimidin-2-yl]benzoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[4-[5-[[1-(2-ethyl-2-fluorobutyl)piperidin-4-yl]methoxy]pyrimidin-2-yl]benzoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 90018430 |
| Molecular Formula | C28H38FN5O3 |
| Molecular Weight | 511.64 g/mol |
| Exact Mass | 511.30 |
| IUPAC Name | (2S)-N-[4-[5-[[1-(2-ethyl-2-fluorobutyl)piperidin-4-yl]methoxy]pyrimidin-2-yl]benzoyl]pyrrolidine-2-carboxamide |
| SMILES | CCC(F)(CC)CN1CCC(COc2cnc(-c3ccc(C(=O)NC(=O)[C@@H]4CCCN4)cc3)nc2)CC1 |
| InChI | InChI=1S/C28H38FN5O3/c1-3-28(29,4-2)19-34-14-11-20(12-15-34)18-37-23-16-31-25(32-17-23)21-7-9-22(10-8-21)26(35)33-27(36)24-6-5-13-30-24/h7-10,16-17,20,24,30H,3-6,11-15,18-19H2,1-2H3,(H,33,35,36)/t24-/m0/s1 |
| InChIKey | XRBKCLJLTAIEHW-DEOSSOPVSA-N |
| XLogP | 3.77 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.64 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|