C18H18N2O4 — CID 118111735
1-(2-methoxyphenyl)-2-(pyridine-3-carbonyl)pyrrolidine-2-carboxylic acid (PubChem CID 118111735) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is 1-(2-methoxyphenyl)-2-(pyridine-3-carbonyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(2-methoxyphenyl)-2-(pyridine-3-carbonyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 118111735 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 1-(2-methoxyphenyl)-2-(pyridine-3-carbonyl)pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccccc1N1CCCC1(C(=O)O)C(=O)c1cccnc1 |
| InChI | InChI=1S/C18H18N2O4/c1-24-15-8-3-2-7-14(15)20-11-5-9-18(20,17(22)23)16(21)13-6-4-10-19-12-13/h2-4,6-8,10,12H,5,9,11H2,1H3,(H,22,23) |
| InChIKey | OXIPXWYIOQASSE-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|