C31H32Br2O2 — CID 118112279
(E)-4-[4-[8-(2,7-dibromo-9H-fluoren-9-yl)octoxy]phenyl]but-3-en-2-one (PubChem CID 118112279) has the molecular formula C31H32Br2O2 and a molecular weight of 596.40 g/mol. Its IUPAC name is (E)-4-[4-[8-(2,7-dibromo-9H-fluoren-9-yl)octoxy]phenyl]but-3-en-2-one.
| Compound Name | (E)-4-[4-[8-(2,7-dibromo-9H-fluoren-9-yl)octoxy]phenyl]but-3-en-2-one |
|---|---|
| PubChem CID | 118112279 |
| Molecular Formula | C31H32Br2O2 |
| Molecular Weight | 596.40 g/mol |
| Exact Mass | 594.08 |
| IUPAC Name | (E)-4-[4-[8-(2,7-dibromo-9H-fluoren-9-yl)octoxy]phenyl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1ccc(OCCCCCCCCC2c3cc(Br)ccc3-c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C31H32Br2O2/c1-22(34)9-10-23-11-15-26(16-12-23)35-19-7-5-3-2-4-6-8-27-30-20-24(32)13-17-28(30)29-18-14-25(33)21-31(27)29/h9-18,20-21,27H,2-8,19H2,1H3/b10-9+ |
| InChIKey | CSTFWFVFDLBUJF-MDZDMXLPSA-N |
| XLogP | 9.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.40 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|