C15H10F3N3O — CID 118112949
N-phenyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine-7-carboxamide (PubChem CID 118112949) has the molecular formula C15H10F3N3O and a molecular weight of 305.26 g/mol. Its IUPAC name is N-phenyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine-7-carboxamide.
| Compound Name | N-phenyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine-7-carboxamide |
|---|---|
| PubChem CID | 118112949 |
| Molecular Formula | C15H10F3N3O |
| Molecular Weight | 305.26 g/mol |
| Exact Mass | 305.08 |
| IUPAC Name | N-phenyl-2-(trifluoromethyl)imidazo[1,2-a]pyridine-7-carboxamide |
| SMILES | O=C(Nc1ccccc1)c1ccn2cc(C(F)(F)F)nc2c1 |
| InChI | InChI=1S/C15H10F3N3O/c16-15(17,18)12-9-21-7-6-10(8-13(21)20-12)14(22)19-11-4-2-1-3-5-11/h1-9H,(H,19,22) |
| InChIKey | HXPAMTMKHXLBBN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.26 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |