C30H30N2O4 — CID 118113369
9-benzyl-4-hydroxy-2-oxo-1-[(4-phenylphenyl)methyl]-1,9-diazaspiro[5.5]undec-3-ene-3-carboxylic acid (PubChem CID 118113369) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is 9-benzyl-4-hydroxy-2-oxo-1-[(4-phenylphenyl)methyl]-1,9-diazaspiro[5.5]undec-3-ene-3-carboxylic acid.
| Compound Name | 9-benzyl-4-hydroxy-2-oxo-1-[(4-phenylphenyl)methyl]-1,9-diazaspiro[5.5]undec-3-ene-3-carboxylic acid |
|---|---|
| PubChem CID | 118113369 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | 9-benzyl-4-hydroxy-2-oxo-1-[(4-phenylphenyl)methyl]-1,9-diazaspiro[5.5]undec-3-ene-3-carboxylic acid |
| SMILES | O=C(O)C1=C(O)CC2(CCN(Cc3ccccc3)CC2)N(Cc2ccc(-c3ccccc3)cc2)C1=O |
| InChI | InChI=1S/C30H30N2O4/c33-26-19-30(15-17-31(18-16-30)20-22-7-3-1-4-8-22)32(28(34)27(26)29(35)36)21-23-11-13-25(14-12-23)24-9-5-2-6-10-24/h1-14,33H,15-21H2,(H,35,36) |
| InChIKey | ZREMOCRSIAVAOV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|