C18H22N2O4 — CID 23435738
2-(9-benzyl-2,4-dioxo-3,9-diazaspiro[5.5]undecan-3-yl)acetic acid (PubChem CID 23435738) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-(9-benzyl-2,4-dioxo-3,9-diazaspiro[5.5]undecan-3-yl)acetic acid.
| Compound Name | 2-(9-benzyl-2,4-dioxo-3,9-diazaspiro[5.5]undecan-3-yl)acetic acid |
|---|---|
| PubChem CID | 23435738 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 2-(9-benzyl-2,4-dioxo-3,9-diazaspiro[5.5]undecan-3-yl)acetic acid |
| SMILES | O=C(O)CN1C(=O)CC2(CCN(Cc3ccccc3)CC2)CC1=O |
| InChI | InChI=1S/C18H22N2O4/c21-15-10-18(11-16(22)20(15)13-17(23)24)6-8-19(9-7-18)12-14-4-2-1-3-5-14/h1-5H,6-13H2,(H,23,24) |
| InChIKey | NHGKKCFXVGRODP-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|