C17H19NO3 — CID 46934489
8-phenacyl-8-azaspiro[4.5]decane-7,9-dione (PubChem CID 46934489) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is 8-phenacyl-8-azaspiro[4.5]decane-7,9-dione.
| Compound Name | 8-phenacyl-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| PubChem CID | 46934489 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 8-phenacyl-8-azaspiro[4.5]decane-7,9-dione |
| SMILES | O=C(CN1C(=O)CC2(CCCC2)CC1=O)c1ccccc1 |
| InChI | InChI=1S/C17H19NO3/c19-14(13-6-2-1-3-7-13)12-18-15(20)10-17(11-16(18)21)8-4-5-9-17/h1-3,6-7H,4-5,8-12H2 |
| InChIKey | LCKFRKWABVSQGI-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|