C14H13Br2N — CID 118113905
N,3-dibromo-4-methyl-N-(4-methylphenyl)aniline (PubChem CID 118113905) has the molecular formula C14H13Br2N and a molecular weight of 355.07 g/mol. Its IUPAC name is N,3-dibromo-4-methyl-N-(4-methylphenyl)aniline.
| Compound Name | N,3-dibromo-4-methyl-N-(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 118113905 |
| Molecular Formula | C14H13Br2N |
| Molecular Weight | 355.07 g/mol |
| Exact Mass | 352.94 |
| IUPAC Name | N,3-dibromo-4-methyl-N-(4-methylphenyl)aniline |
| SMILES | Cc1ccc(N(Br)c2ccc(C)c(Br)c2)cc1 |
| InChI | InChI=1S/C14H13Br2N/c1-10-3-6-12(7-4-10)17(16)13-8-5-11(2)14(15)9-13/h3-9H,1-2H3 |
| InChIKey | CMVWAXADMJIZQM-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.07 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|