C26H27NO4 — CID 11811804
(E)-3-(3,5-dimethoxy-4-phenylmethoxyphenyl)-N-(2,4-dimethylphenyl)prop-2-enamide (PubChem CID 11811804) has the molecular formula C26H27NO4 and a molecular weight of 417.51 g/mol. Its IUPAC name is (E)-3-(3,5-dimethoxy-4-phenylmethoxyphenyl)-N-(2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(3,5-dimethoxy-4-phenylmethoxyphenyl)-N-(2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 11811804 |
| Molecular Formula | C26H27NO4 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.19 |
| IUPAC Name | (E)-3-(3,5-dimethoxy-4-phenylmethoxyphenyl)-N-(2,4-dimethylphenyl)prop-2-enamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(C)cc2C)cc(OC)c1OCc1ccccc1 |
| InChI | InChI=1S/C26H27NO4/c1-18-10-12-22(19(2)14-18)27-25(28)13-11-21-15-23(29-3)26(24(16-21)30-4)31-17-20-8-6-5-7-9-20/h5-16H,17H2,1-4H3,(H,27,28)/b13-11+ |
| InChIKey | WAZKRDSZKOHICM-ACCUITESSA-N |
| XLogP | 5.55 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|