About 1-[2-(benzenesulfinyl)phenyl]pentan-1-one;carbon monoxide;chromium
1-[2-(benzenesulfinyl)phenyl]pentan-1-one;carbon monoxide;chromium (PubChem CID 11811896) has the molecular formula C20H18CrO5S
and a molecular weight of 422.42 g/mol. Its IUPAC name is 1-[2-(benzenesulfinyl)phenyl]pentan-1-one;carbon monoxide;chromium.
Molecular Properties
| Compound Name | 1-[2-(benzenesulfinyl)phenyl]pentan-1-one;carbon monoxide;chromium |
| PubChem CID | 11811896 |
| Molecular Formula | C20H18CrO5S |
| Molecular Weight | 422.42 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 1-[2-(benzenesulfinyl)phenyl]pentan-1-one;carbon monoxide;chromium |
| SMILES | CCCCC(=O)c1ccccc1S(=O)c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C17H18O2S.3CO.Cr/c1-2-3-12-16(18)15-11-7-8-13-17(15)20(19)14-9-5-4-6-10-14;3*1-2;/h4-11,13H,2-3,12H2,1H3;;;; |
| InChIKey | IKLJCKTVZDOZLZ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 93.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 1-[2-(benzenesulfinyl)phenyl]pentan-1-one;carbon monoxide;chromium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(benzenesulfinyl)phenyl]pentan-1-one;carbon monoxide;chromium?
The IUPAC name of 1-[2-(benzenesulfinyl)phenyl]pentan-1-one;carbon monoxide;chromium (CID 11811896) is 1-[2-(benzenesulfinyl)phenyl]pentan-1-one;carbon monoxide;chromium.
What is the SMILES notation for 1-[2-(benzenesulfinyl)phenyl]pentan-1-one;carbon monoxide;chromium?
The canonical SMILES for 1-[2-(benzenesulfinyl)phenyl]pentan-1-one;carbon monoxide;chromium is CCCCC(=O)c1ccccc1S(=O)c1ccccc1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr].
What is the InChIKey of 1-[2-(benzenesulfinyl)phenyl]pentan-1-one;carbon monoxide;chromium?
The InChIKey is IKLJCKTVZDOZLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18O2S.3CO.Cr/c1-2-3-12-16(18)15-11-7-8-13-17(15)20(19)14-9-5-4-6-10-14;3*1-2;/h4-11,13H,2-3,12H2,1H3;;;;.
What are the key properties of 1-[2-(benzenesulfinyl)phenyl]pentan-1-one;carbon monoxide;chromium?
1-[2-(benzenesulfinyl)phenyl]pentan-1-one;carbon monoxide;chromium has a molecular weight of 422.42 g/mol, XLogP of 4.11, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(benzenesulfinyl)phenyl]pentan-1-one;carbon monoxide;chromium is sourced from PubChem (CID 11811896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).