C25H29N4O4+ — CID 11812385
[(2S)-1-[[(1S)-1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-3-(7-hydroxy-1H-indol-3-yl)-1-oxopropan-2-yl]-trimethylazanium (PubChem CID 11812385) has the molecular formula C25H29N4O4+ and a molecular weight of 449.53 g/mol. Its IUPAC name is [(2S)-1-[[(1S)-1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-3-(7-hydroxy-1H-indol-3-yl)-1-oxopropan-2-yl]-trimethylazanium.
| Compound Name | [(2S)-1-[[(1S)-1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-3-(7-hydroxy-1H-indol-3-yl)-1-oxopropan-2-yl]-trimethylazanium |
|---|---|
| PubChem CID | 11812385 |
| Molecular Formula | C25H29N4O4+ |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | [(2S)-1-[[(1S)-1-carboxy-2-(1H-indol-3-yl)ethyl]amino]-3-(7-hydroxy-1H-indol-3-yl)-1-oxopropan-2-yl]-trimethylazanium |
| SMILES | C[N+](C)(C)[C@@H](Cc1c[nH]c2c(O)cccc12)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O |
| InChI | InChI=1S/C25H28N4O4/c1-29(2,3)21(12-16-14-27-23-18(16)8-6-10-22(23)30)24(31)28-20(25(32)33)11-15-13-26-19-9-5-4-7-17(15)19/h4-10,13-14,20-21,26-27H,11-12H2,1-3H3,(H2-,28,30,31,32,33)/p+1/t20-,21-/m0/s1 |
| InChIKey | KOHUEEUANZYMSP-SFTDATJTSA-O |
| XLogP | 2.78 |
| TPSA | 118.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|