C11H23NO4 — CID 118124310
(2S,3S,4S,5R,6R)-5-(3-aminopropoxy)-2-(hydroxymethyl)-3,6-dimethyloxan-4-ol (PubChem CID 118124310) has the molecular formula C11H23NO4 and a molecular weight of 233.31 g/mol. Its IUPAC name is (2S,3S,4S,5R,6R)-5-(3-aminopropoxy)-2-(hydroxymethyl)-3,6-dimethyloxan-4-ol.
| Compound Name | (2S,3S,4S,5R,6R)-5-(3-aminopropoxy)-2-(hydroxymethyl)-3,6-dimethyloxan-4-ol |
|---|---|
| PubChem CID | 118124310 |
| Molecular Formula | C11H23NO4 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | (2S,3S,4S,5R,6R)-5-(3-aminopropoxy)-2-(hydroxymethyl)-3,6-dimethyloxan-4-ol |
| SMILES | C[C@H]1[C@H](O)[C@@H](OCCCN)[C@@H](C)O[C@@H]1CO |
| InChI | InChI=1S/C11H23NO4/c1-7-9(6-13)16-8(2)11(10(7)14)15-5-3-4-12/h7-11,13-14H,3-6,12H2,1-2H3/t7-,8-,9-,10+,11+/m1/s1 |
| InChIKey | RQTKEPFCKWSOQD-APLZJWDSSA-N |
| XLogP | -0.50 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|