C32H34F3N7O2 — CID 118126953
N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-(triazol-1-yl)cyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-4-ylmethyl)phenyl]-5-fluoropyridine-2-carboxamide (PubChem CID 118126953) has the molecular formula C32H34F3N7O2 and a molecular weight of 605.67 g/mol. Its IUPAC name is N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-(triazol-1-yl)cyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-4-ylmethyl)phenyl]-5-fluoropyridine-2-carboxamide.
| Compound Name | N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-(triazol-1-yl)cyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-4-ylmethyl)phenyl]-5-fluoropyridine-2-carboxamide |
|---|---|
| PubChem CID | 118126953 |
| Molecular Formula | C32H34F3N7O2 |
| Molecular Weight | 605.67 g/mol |
| Exact Mass | 605.27 |
| IUPAC Name | N-[4-[(1R,3R,4S,5S)-3-amino-5-methyl-4-(triazol-1-yl)cyclohexyl]-3-pyridinyl]-6-[2,6-difluoro-4-(oxan-4-ylmethyl)phenyl]-5-fluoropyridine-2-carboxamide |
| SMILES | C[C@H]1C[C@@H](c2ccncc2NC(=O)c2ccc(F)c(-c3c(F)cc(CC4CCOCC4)cc3F)n2)C[C@@H](N)[C@H]1n1ccnn1 |
| InChI | InChI=1S/C32H34F3N7O2/c1-18-12-21(16-26(36)31(18)42-9-8-38-41-42)22-4-7-37-17-28(22)40-32(43)27-3-2-23(33)30(39-27)29-24(34)14-20(15-25(29)35)13-19-5-10-44-11-6-19/h2-4,7-9,14-15,17-19,21,26,31H,5-6,10-13,16,36H2,1H3,(H,40,43)/t18-,21+,26+,31-/m0/s1 |
| InChIKey | XMSPFSFZKUZZHS-LJGQWETGSA-N |
| XLogP | 5.46 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.67 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |