C17H13N5O — CID 118129230
4-phenyl-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrole-3-carboxamide (PubChem CID 118129230) has the molecular formula C17H13N5O and a molecular weight of 303.33 g/mol. Its IUPAC name is 4-phenyl-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrole-3-carboxamide.
| Compound Name | 4-phenyl-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 118129230 |
| Molecular Formula | C17H13N5O |
| Molecular Weight | 303.33 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 4-phenyl-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrole-3-carboxamide |
| SMILES | NC(=O)c1cn(-c2ncnc3[nH]ccc23)cc1-c1ccccc1 |
| InChI | InChI=1S/C17H13N5O/c18-15(23)14-9-22(8-13(14)11-4-2-1-3-5-11)17-12-6-7-19-16(12)20-10-21-17/h1-10H,(H2,18,23)(H,19,20,21) |
| InChIKey | IBAKZUHOEWYQRB-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.33 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |