C18H13IN5+ — CID 163927016
[3-[4-cyano-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrol-3-yl]-4-methylphenyl]iodanium (PubChem CID 163927016) has the molecular formula C18H13IN5+ and a molecular weight of 426.24 g/mol. Its IUPAC name is [3-[4-cyano-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrol-3-yl]-4-methylphenyl]iodanium.
| Compound Name | [3-[4-cyano-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrol-3-yl]-4-methylphenyl]iodanium |
|---|---|
| PubChem CID | 163927016 |
| Molecular Formula | C18H13IN5+ |
| Molecular Weight | 426.24 g/mol |
| Exact Mass | 426.02 |
| IUPAC Name | [3-[4-cyano-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)pyrrol-3-yl]-4-methylphenyl]iodanium |
| SMILES | Cc1ccc([IH+])cc1-c1cn(-c2ncnc3[nH]ccc23)cc1C#N |
| InChI | InChI=1S/C18H13IN5/c1-11-2-3-13(19)6-15(11)16-9-24(8-12(16)7-20)18-14-4-5-21-17(14)22-10-23-18/h2-6,8-10,19H,1H3,(H,21,22,23)/q+1 |
| InChIKey | RFJKVKGBESXNOU-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 70.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.24 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|