C14H9N3 — CID 58896795
2-(1H-pyrrolo[2,3-b]pyridin-4-yl)benzonitrile (PubChem CID 58896795) has the molecular formula C14H9N3 and a molecular weight of 219.25 g/mol. Its IUPAC name is 2-(1H-pyrrolo[2,3-b]pyridin-4-yl)benzonitrile.
| Compound Name | 2-(1H-pyrrolo[2,3-b]pyridin-4-yl)benzonitrile |
|---|---|
| PubChem CID | 58896795 |
| Molecular Formula | C14H9N3 |
| Molecular Weight | 219.25 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 2-(1H-pyrrolo[2,3-b]pyridin-4-yl)benzonitrile |
| SMILES | N#Cc1ccccc1-c1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C14H9N3/c15-9-10-3-1-2-4-11(10)12-5-7-16-14-13(12)6-8-17-14/h1-8H,(H,16,17) |
| InChIKey | WDFQWVXAMJILDH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.25 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |