C14H8N4 — CID 142880710
2-pyrido[2,3-b]pyrazin-8-ylbenzonitrile (PubChem CID 142880710) has the molecular formula C14H8N4 and a molecular weight of 232.25 g/mol. Its IUPAC name is 2-pyrido[2,3-b]pyrazin-8-ylbenzonitrile.
| Compound Name | 2-pyrido[2,3-b]pyrazin-8-ylbenzonitrile |
|---|---|
| PubChem CID | 142880710 |
| Molecular Formula | C14H8N4 |
| Molecular Weight | 232.25 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-pyrido[2,3-b]pyrazin-8-ylbenzonitrile |
| SMILES | N#Cc1ccccc1-c1ccnc2nccnc12 |
| InChI | InChI=1S/C14H8N4/c15-9-10-3-1-2-4-11(10)12-5-6-17-14-13(12)16-7-8-18-14/h1-8H |
| InChIKey | XZFXYDQJEKHWPB-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 62.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |