C14H8N2OS — CID 175011567
2-(7-hydroxy-1,3-benzothiazol-6-yl)benzonitrile (PubChem CID 175011567) has the molecular formula C14H8N2OS and a molecular weight of 252.30 g/mol. Its IUPAC name is 2-(7-hydroxy-1,3-benzothiazol-6-yl)benzonitrile.
| Compound Name | 2-(7-hydroxy-1,3-benzothiazol-6-yl)benzonitrile |
|---|---|
| PubChem CID | 175011567 |
| Molecular Formula | C14H8N2OS |
| Molecular Weight | 252.30 g/mol |
| Exact Mass | 252.04 |
| IUPAC Name | 2-(7-hydroxy-1,3-benzothiazol-6-yl)benzonitrile |
| SMILES | N#Cc1ccccc1-c1ccc2ncsc2c1O |
| InChI | InChI=1S/C14H8N2OS/c15-7-9-3-1-2-4-10(9)11-5-6-12-14(13(11)17)18-8-16-12/h1-6,8,17H |
| InChIKey | GBNGTWIUNQMSMN-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 56.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |