About 7-ethyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile
7-ethyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile (PubChem CID 58612187) has the molecular formula C9H7N3S
and a molecular weight of 189.24 g/mol. Its IUPAC name is 7-ethyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile.
Analyze 7-ethyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile?
The IUPAC name of 7-ethyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile (CID 58612187) is 7-ethyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile.
What is the SMILES notation for 7-ethyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile?
The canonical SMILES for 7-ethyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile is CCc1c(C#N)cnc2ncsc12.
What is the InChIKey of 7-ethyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile?
The InChIKey is WXIVKEIEQNOAAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N3S/c1-2-7-6(3-10)4-11-9-8(7)13-5-12-9/h4-5H,2H2,1H3.
What are the key properties of 7-ethyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile?
7-ethyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile has a molecular weight of 189.24 g/mol, XLogP of 2.13, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethyl-[1,3]thiazolo[4,5-b]pyridine-6-carbonitrile is sourced from PubChem (CID 58612187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).