C8H3BrN2S — CID 131417746
4-bromo-1,3-benzothiazole-7-carbonitrile (PubChem CID 131417746) has the molecular formula C8H3BrN2S and a molecular weight of 239.10 g/mol. Its IUPAC name is 4-bromo-1,3-benzothiazole-7-carbonitrile.
| Compound Name | 4-bromo-1,3-benzothiazole-7-carbonitrile |
|---|---|
| PubChem CID | 131417746 |
| Molecular Formula | C8H3BrN2S |
| Molecular Weight | 239.10 g/mol |
| Exact Mass | 237.92 |
| IUPAC Name | 4-bromo-1,3-benzothiazole-7-carbonitrile |
| SMILES | N#Cc1ccc(Br)c2ncsc12 |
| InChI | InChI=1S/C8H3BrN2S/c9-6-2-1-5(3-10)8-7(6)11-4-12-8/h1-2,4H |
| InChIKey | OBZLKTVJWVFPKA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.10 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |