About 4-bromo-7-(trifluoromethyl)-1,3-benzothiazole
4-bromo-7-(trifluoromethyl)-1,3-benzothiazole (PubChem CID 163381240) has the molecular formula C8H3BrF3NS
and a molecular weight of 282.08 g/mol. Its IUPAC name is 4-bromo-7-(trifluoromethyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 4-bromo-7-(trifluoromethyl)-1,3-benzothiazole |
| PubChem CID | 163381240 |
| Molecular Formula | C8H3BrF3NS |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 280.91 |
| IUPAC Name | 4-bromo-7-(trifluoromethyl)-1,3-benzothiazole |
| SMILES | FC(F)(F)c1ccc(Br)c2ncsc12 |
| InChI | InChI=1S/C8H3BrF3NS/c9-5-2-1-4(8(10,11)12)7-6(5)13-3-14-7/h1-3H |
| InChIKey | PXYIDJBNDMWHGD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-bromo-7-(trifluoromethyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-7-(trifluoromethyl)-1,3-benzothiazole?
The IUPAC name of 4-bromo-7-(trifluoromethyl)-1,3-benzothiazole (CID 163381240) is 4-bromo-7-(trifluoromethyl)-1,3-benzothiazole.
What is the SMILES notation for 4-bromo-7-(trifluoromethyl)-1,3-benzothiazole?
The canonical SMILES for 4-bromo-7-(trifluoromethyl)-1,3-benzothiazole is FC(F)(F)c1ccc(Br)c2ncsc12.
What is the InChIKey of 4-bromo-7-(trifluoromethyl)-1,3-benzothiazole?
The InChIKey is PXYIDJBNDMWHGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H3BrF3NS/c9-5-2-1-4(8(10,11)12)7-6(5)13-3-14-7/h1-3H.
What are the key properties of 4-bromo-7-(trifluoromethyl)-1,3-benzothiazole?
4-bromo-7-(trifluoromethyl)-1,3-benzothiazole has a molecular weight of 282.08 g/mol, XLogP of 4.08, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-7-(trifluoromethyl)-1,3-benzothiazole is sourced from PubChem (CID 163381240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).