C8H3BrF3NS — CID 163381240
4-bromo-7-(trifluoromethyl)-1,3-benzothiazole (PubChem CID 163381240) has the molecular formula C8H3BrF3NS and a molecular weight of 282.08 g/mol. Its IUPAC name is 4-bromo-7-(trifluoromethyl)-1,3-benzothiazole.
| Compound Name | 4-bromo-7-(trifluoromethyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 163381240 |
| Molecular Formula | C8H3BrF3NS |
| Molecular Weight | 282.08 g/mol |
| Exact Mass | 280.91 |
| IUPAC Name | 4-bromo-7-(trifluoromethyl)-1,3-benzothiazole |
| SMILES | FC(F)(F)c1ccc(Br)c2ncsc12 |
| InChI | InChI=1S/C8H3BrF3NS/c9-5-2-1-4(8(10,11)12)7-6(5)13-3-14-7/h1-3H |
| InChIKey | PXYIDJBNDMWHGD-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.08 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |