C10H5N3OS — CID 119083899
2-(1,3-benzothiazol-4-yloxy)propanedinitrile (PubChem CID 119083899) has the molecular formula C10H5N3OS and a molecular weight of 215.24 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-4-yloxy)propanedinitrile.
| Compound Name | 2-(1,3-benzothiazol-4-yloxy)propanedinitrile |
|---|---|
| PubChem CID | 119083899 |
| Molecular Formula | C10H5N3OS |
| Molecular Weight | 215.24 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | 2-(1,3-benzothiazol-4-yloxy)propanedinitrile |
| SMILES | N#CC(C#N)Oc1cccc2scnc12 |
| InChI | InChI=1S/C10H5N3OS/c11-4-7(5-12)14-8-2-1-3-9-10(8)13-6-15-9/h1-3,6-7H |
| InChIKey | CZWFUKJFJUIZNZ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |