C10H12N2OS — CID 43451523
5-propan-2-yloxy-1,3-benzothiazol-4-amine (PubChem CID 43451523) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is 5-propan-2-yloxy-1,3-benzothiazol-4-amine.
| Compound Name | 5-propan-2-yloxy-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 43451523 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 5-propan-2-yloxy-1,3-benzothiazol-4-amine |
| SMILES | CC(C)Oc1ccc2scnc2c1N |
| InChI | InChI=1S/C10H12N2OS/c1-6(2)13-7-3-4-8-10(9(7)11)12-5-14-8/h3-6H,11H2,1-2H3 |
| InChIKey | BDUSPHLQFJAMFT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|