C19H16N2O3S4 — CID 159966886
methanedithione;4-methoxy-1,3-benzothiazole;1-(4-methoxy-1,3-benzothiazol-7-yl)ethanone (PubChem CID 159966886) has the molecular formula C19H16N2O3S4 and a molecular weight of 448.62 g/mol. Its IUPAC name is methanedithione;4-methoxy-1,3-benzothiazole;1-(4-methoxy-1,3-benzothiazol-7-yl)ethanone.
| Compound Name | methanedithione;4-methoxy-1,3-benzothiazole;1-(4-methoxy-1,3-benzothiazol-7-yl)ethanone |
|---|---|
| PubChem CID | 159966886 |
| Molecular Formula | C19H16N2O3S4 |
| Molecular Weight | 448.62 g/mol |
| Exact Mass | 448.00 |
| IUPAC Name | methanedithione;4-methoxy-1,3-benzothiazole;1-(4-methoxy-1,3-benzothiazol-7-yl)ethanone |
| SMILES | COc1ccc(C(C)=O)c2scnc12.COc1cccc2scnc12.S=C=S |
| InChI | InChI=1S/C10H9NO2S.C8H7NOS.CS2/c1-6(12)7-3-4-8(13-2)9-10(7)14-5-11-9;1-10-6-3-2-4-7-8(6)9-5-11-7;2-1-3/h3-5H,1-2H3;2-5H,1H3; |
| InChIKey | OEAWOLVHRBALHW-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.62 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|