About 1-(1,3-benzothiazol-4-yl)-N,N-dimethylmethanamine
1-(1,3-benzothiazol-4-yl)-N,N-dimethylmethanamine (PubChem CID 173153815) has the molecular formula C10H12N2S
and a molecular weight of 192.29 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-4-yl)-N,N-dimethylmethanamine.
Molecular Properties
| Compound Name | 1-(1,3-benzothiazol-4-yl)-N,N-dimethylmethanamine |
| PubChem CID | 173153815 |
| Molecular Formula | C10H12N2S |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 1-(1,3-benzothiazol-4-yl)-N,N-dimethylmethanamine |
| SMILES | CN(C)Cc1cccc2scnc12 |
| InChI | InChI=1S/C10H12N2S/c1-12(2)6-8-4-3-5-9-10(8)11-7-13-9/h3-5,7H,6H2,1-2H3 |
| InChIKey | VIEMQCDVZPNRDE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,3-benzothiazol-4-yl)-N,N-dimethylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-benzothiazol-4-yl)-N,N-dimethylmethanamine?
The IUPAC name of 1-(1,3-benzothiazol-4-yl)-N,N-dimethylmethanamine (CID 173153815) is 1-(1,3-benzothiazol-4-yl)-N,N-dimethylmethanamine.
What is the SMILES notation for 1-(1,3-benzothiazol-4-yl)-N,N-dimethylmethanamine?
The canonical SMILES for 1-(1,3-benzothiazol-4-yl)-N,N-dimethylmethanamine is CN(C)Cc1cccc2scnc12.
What is the InChIKey of 1-(1,3-benzothiazol-4-yl)-N,N-dimethylmethanamine?
The InChIKey is VIEMQCDVZPNRDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2S/c1-12(2)6-8-4-3-5-9-10(8)11-7-13-9/h3-5,7H,6H2,1-2H3.
What are the key properties of 1-(1,3-benzothiazol-4-yl)-N,N-dimethylmethanamine?
1-(1,3-benzothiazol-4-yl)-N,N-dimethylmethanamine has a molecular weight of 192.29 g/mol, XLogP of 2.36, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzothiazol-4-yl)-N,N-dimethylmethanamine is sourced from PubChem (CID 173153815), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).