About 4-(2-chloroethyl)-1,3-benzothiazole
4-(2-chloroethyl)-1,3-benzothiazole (PubChem CID 174440026) has the molecular formula C9H8ClNS
and a molecular weight of 197.69 g/mol. Its IUPAC name is 4-(2-chloroethyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 4-(2-chloroethyl)-1,3-benzothiazole |
| PubChem CID | 174440026 |
| Molecular Formula | C9H8ClNS |
| Molecular Weight | 197.69 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 4-(2-chloroethyl)-1,3-benzothiazole |
| SMILES | ClCCc1cccc2scnc12 |
| InChI | InChI=1S/C9H8ClNS/c10-5-4-7-2-1-3-8-9(7)11-6-12-8/h1-3,6H,4-5H2 |
| InChIKey | CISIPJOBHZZWEA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.69 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(2-chloroethyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chloroethyl)-1,3-benzothiazole?
The IUPAC name of 4-(2-chloroethyl)-1,3-benzothiazole (CID 174440026) is 4-(2-chloroethyl)-1,3-benzothiazole.
What is the SMILES notation for 4-(2-chloroethyl)-1,3-benzothiazole?
The canonical SMILES for 4-(2-chloroethyl)-1,3-benzothiazole is ClCCc1cccc2scnc12.
What is the InChIKey of 4-(2-chloroethyl)-1,3-benzothiazole?
The InChIKey is CISIPJOBHZZWEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8ClNS/c10-5-4-7-2-1-3-8-9(7)11-6-12-8/h1-3,6H,4-5H2.
What are the key properties of 4-(2-chloroethyl)-1,3-benzothiazole?
4-(2-chloroethyl)-1,3-benzothiazole has a molecular weight of 197.69 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chloroethyl)-1,3-benzothiazole is sourced from PubChem (CID 174440026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).