C9H8ClNS — CID 174440026
4-(2-chloroethyl)-1,3-benzothiazole (PubChem CID 174440026) has the molecular formula C9H8ClNS and a molecular weight of 197.69 g/mol. Its IUPAC name is 4-(2-chloroethyl)-1,3-benzothiazole.
| Compound Name | 4-(2-chloroethyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 174440026 |
| Molecular Formula | C9H8ClNS |
| Molecular Weight | 197.69 g/mol |
| Exact Mass | 197.01 |
| IUPAC Name | 4-(2-chloroethyl)-1,3-benzothiazole |
| SMILES | ClCCc1cccc2scnc12 |
| InChI | InChI=1S/C9H8ClNS/c10-5-4-7-2-1-3-8-9(7)11-6-12-8/h1-3,6H,4-5H2 |
| InChIKey | CISIPJOBHZZWEA-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.69 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|