C16H13BrN2S2 — CID 159796626
4-(bromomethyl)-1,3-benzothiazole;4-methyl-1,3-benzothiazole (PubChem CID 159796626) has the molecular formula C16H13BrN2S2 and a molecular weight of 377.33 g/mol. Its IUPAC name is 4-(bromomethyl)-1,3-benzothiazole;4-methyl-1,3-benzothiazole.
| Compound Name | 4-(bromomethyl)-1,3-benzothiazole;4-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 159796626 |
| Molecular Formula | C16H13BrN2S2 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 375.97 |
| IUPAC Name | 4-(bromomethyl)-1,3-benzothiazole;4-methyl-1,3-benzothiazole |
| SMILES | BrCc1cccc2scnc12.Cc1cccc2scnc12 |
| InChI | InChI=1S/C8H6BrNS.C8H7NS/c9-4-6-2-1-3-7-8(6)10-5-11-7;1-6-3-2-4-7-8(6)9-5-10-7/h1-3,5H,4H2;2-5H,1H3 |
| InChIKey | NJGFDDUCUIYGGF-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|