C9H3Br2NS — CID 130953719
4,7-dibromo-1-benzothiophene-3-carbonitrile (PubChem CID 130953719) has the molecular formula C9H3Br2NS and a molecular weight of 317.01 g/mol. Its IUPAC name is 4,7-dibromo-1-benzothiophene-3-carbonitrile.
| Compound Name | 4,7-dibromo-1-benzothiophene-3-carbonitrile |
|---|---|
| PubChem CID | 130953719 |
| Molecular Formula | C9H3Br2NS |
| Molecular Weight | 317.01 g/mol |
| Exact Mass | 314.84 |
| IUPAC Name | 4,7-dibromo-1-benzothiophene-3-carbonitrile |
| SMILES | N#Cc1csc2c(Br)ccc(Br)c12 |
| InChI | InChI=1S/C9H3Br2NS/c10-6-1-2-7(11)9-8(6)5(3-12)4-13-9/h1-2,4H |
| InChIKey | CQRYCWYLJIQERN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.01 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |