C10H6N4S — CID 90901282
7-(1,3,5-triazin-2-yl)-1,3-benzothiazole (PubChem CID 90901282) has the molecular formula C10H6N4S and a molecular weight of 214.25 g/mol. Its IUPAC name is 7-(1,3,5-triazin-2-yl)-1,3-benzothiazole.
| Compound Name | 7-(1,3,5-triazin-2-yl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 90901282 |
| Molecular Formula | C10H6N4S |
| Molecular Weight | 214.25 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 7-(1,3,5-triazin-2-yl)-1,3-benzothiazole |
| SMILES | c1cc(-c2ncncn2)c2scnc2c1 |
| InChI | InChI=1S/C10H6N4S/c1-2-7(10-12-4-11-5-13-10)9-8(3-1)14-6-15-9/h1-6H |
| InChIKey | HEKDAQNNPZLYDW-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.25 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |