About 2-(1,3-benzothiazol-7-yl)-6-hydrazinylaniline
2-(1,3-benzothiazol-7-yl)-6-hydrazinylaniline (PubChem CID 91034302) has the molecular formula C13H12N4S
and a molecular weight of 256.33 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-7-yl)-6-hydrazinylaniline.
Molecular Properties
| Compound Name | 2-(1,3-benzothiazol-7-yl)-6-hydrazinylaniline |
| PubChem CID | 91034302 |
| Molecular Formula | C13H12N4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 2-(1,3-benzothiazol-7-yl)-6-hydrazinylaniline |
| SMILES | NNc1cccc(-c2cccc3ncsc23)c1N |
| InChI | InChI=1S/C13H12N4S/c14-12-8(3-1-5-10(12)17-15)9-4-2-6-11-13(9)18-7-16-11/h1-7,17H,14-15H2 |
| InChIKey | WXHPASXISXGPQF-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-benzothiazol-7-yl)-6-hydrazinylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-benzothiazol-7-yl)-6-hydrazinylaniline?
The IUPAC name of 2-(1,3-benzothiazol-7-yl)-6-hydrazinylaniline (CID 91034302) is 2-(1,3-benzothiazol-7-yl)-6-hydrazinylaniline.
What is the SMILES notation for 2-(1,3-benzothiazol-7-yl)-6-hydrazinylaniline?
The canonical SMILES for 2-(1,3-benzothiazol-7-yl)-6-hydrazinylaniline is NNc1cccc(-c2cccc3ncsc23)c1N.
What is the InChIKey of 2-(1,3-benzothiazol-7-yl)-6-hydrazinylaniline?
The InChIKey is WXHPASXISXGPQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12N4S/c14-12-8(3-1-5-10(12)17-15)9-4-2-6-11-13(9)18-7-16-11/h1-7,17H,14-15H2.
What are the key properties of 2-(1,3-benzothiazol-7-yl)-6-hydrazinylaniline?
2-(1,3-benzothiazol-7-yl)-6-hydrazinylaniline has a molecular weight of 256.33 g/mol, XLogP of 2.83, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-benzothiazol-7-yl)-6-hydrazinylaniline is sourced from PubChem (CID 91034302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).