C10H7N3S — CID 107936704
2-(5-amino-1,3-thiazol-4-yl)benzonitrile (PubChem CID 107936704) has the molecular formula C10H7N3S and a molecular weight of 201.25 g/mol. Its IUPAC name is 2-(5-amino-1,3-thiazol-4-yl)benzonitrile.
| Compound Name | 2-(5-amino-1,3-thiazol-4-yl)benzonitrile |
|---|---|
| PubChem CID | 107936704 |
| Molecular Formula | C10H7N3S |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.04 |
| IUPAC Name | 2-(5-amino-1,3-thiazol-4-yl)benzonitrile |
| SMILES | N#Cc1ccccc1-c1ncsc1N |
| InChI | InChI=1S/C10H7N3S/c11-5-7-3-1-2-4-8(7)9-10(12)14-6-13-9/h1-4,6H,12H2 |
| InChIKey | FELNMZJESDQFCA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |