C13H7N3S — CID 39818616
2-thieno[3,2-d]pyrimidin-4-ylbenzonitrile (PubChem CID 39818616) has the molecular formula C13H7N3S and a molecular weight of 237.29 g/mol. Its IUPAC name is 2-thieno[3,2-d]pyrimidin-4-ylbenzonitrile.
| Compound Name | 2-thieno[3,2-d]pyrimidin-4-ylbenzonitrile |
|---|---|
| PubChem CID | 39818616 |
| Molecular Formula | C13H7N3S |
| Molecular Weight | 237.29 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | 2-thieno[3,2-d]pyrimidin-4-ylbenzonitrile |
| SMILES | N#Cc1ccccc1-c1ncnc2ccsc12 |
| InChI | InChI=1S/C13H7N3S/c14-7-9-3-1-2-4-10(9)12-13-11(5-6-17-13)15-8-16-12/h1-6,8H |
| InChIKey | FZRCBUIKYOIPNN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.29 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |