C12H4F3IrN2S- — CID 58661163
iridium;4-(3,4,5-trifluorobenzene-6-id-1-yl)thieno[3,2-d]pyrimidine (PubChem CID 58661163) has the molecular formula C12H4F3IrN2S- and a molecular weight of 457.46 g/mol. Its IUPAC name is iridium;4-(3,4,5-trifluorobenzene-6-id-1-yl)thieno[3,2-d]pyrimidine.
| Compound Name | iridium;4-(3,4,5-trifluorobenzene-6-id-1-yl)thieno[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 58661163 |
| Molecular Formula | C12H4F3IrN2S- |
| Molecular Weight | 457.46 g/mol |
| Exact Mass | 457.97 |
| IUPAC Name | iridium;4-(3,4,5-trifluorobenzene-6-id-1-yl)thieno[3,2-d]pyrimidine |
| SMILES | Fc1[c-]c(-c2ncnc3ccsc23)cc(F)c1F.[Ir] |
| InChI | InChI=1S/C12H4F3N2S.Ir/c13-7-3-6(4-8(14)10(7)15)11-12-9(1-2-18-12)16-5-17-11;/h1-3,5H;/q-1; |
| InChIKey | IJMWQGOHPFPAPR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.46 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|