C31H38ClN5O2S — CID 118130584
1-[2-[4-chloro-1'-(2,2-dimethylpropyl)-7-hydroxyspiro[2H-indole-3,4'-piperidine]-1-yl]phenyl]-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)urea (PubChem CID 118130584) has the molecular formula C31H38ClN5O2S and a molecular weight of 580.20 g/mol. Its IUPAC name is 1-[2-[4-chloro-1'-(2,2-dimethylpropyl)-7-hydroxyspiro[2H-indole-3,4'-piperidine]-1-yl]phenyl]-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-[2-[4-chloro-1'-(2,2-dimethylpropyl)-7-hydroxyspiro[2H-indole-3,4'-piperidine]-1-yl]phenyl]-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 118130584 |
| Molecular Formula | C31H38ClN5O2S |
| Molecular Weight | 580.20 g/mol |
| Exact Mass | 579.24 |
| IUPAC Name | 1-[2-[4-chloro-1'-(2,2-dimethylpropyl)-7-hydroxyspiro[2H-indole-3,4'-piperidine]-1-yl]phenyl]-3-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)urea |
| SMILES | CC(C)(C)CN1CCC2(CC1)CN(c1ccccc1NC(=O)Nc1nc3c(s1)CCCC3)c1c(O)ccc(Cl)c12 |
| InChI | InChI=1S/C31H38ClN5O2S/c1-30(2,3)18-36-16-14-31(15-17-36)19-37(27-24(38)13-12-20(32)26(27)31)23-10-6-4-8-21(23)33-28(39)35-29-34-22-9-5-7-11-25(22)40-29/h4,6,8,10,12-13,38H,5,7,9,11,14-19H2,1-3H3,(H2,33,34,35,39) |
| InChIKey | ADLCGJKRUBYLGT-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 80.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.20 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |